
99-34-3
| Name | 3,5-Dinitrobenzoic acid |
| CAS | 99-34-3 |
| EINECS(EC#) | 202-751-1 |
| Molecular Formula | C7H4N2O6 |
| MDL Number | MFCD00007253 |
| Molecular Weight | 212.12 |
| MOL File | 99-34-3.mol |
Chemical Properties
| Appearance | white or off-white solid |
| Melting point | 204-206 °C (lit.) |
| Boiling point | 351.93°C (rough estimate) |
| density | 1.683 |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble0.5g/10 mL, clear, yellow to very deep greenish-yellow |
| form | Solid |
| pka | pK1:2.85 (25°C) |
| color | Yellow crystalline |
| PH Range | 2.7 |
| Stability: | Stable. Contact with strong bases may lead to fire. Incompatible with strong bases, strong oxidizing agents. |
| Water Solubility | 1350 mg/L (25 ºC) |
| Merck | 14,3276 |
| BRN | 1914286 |
| Henry's Law Constant | 8.0×104 mol/(m3Pa) at 25℃, Abraham and Jr. (2019) |
| InChI | 1S/C7H4N2O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11) |
| InChIKey | VYWYYJYRVSBHJQ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H413 |
| Precautionary statements | P261-P264-P273-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN1325 |
| WGK Germany | 3 |
| RTECS | DG9140700 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
